C15H11N5S — CID 82068723
3,6-dipyridin-4-ylimidazo[2,1-b][1,3]thiazol-5-amine (PubChem CID 82068723) has the molecular formula C15H11N5S and a molecular weight of 293.36 g/mol. Its IUPAC name is 3,6-dipyridin-4-ylimidazo[2,1-b][1,3]thiazol-5-amine.
| Compound Name | 3,6-dipyridin-4-ylimidazo[2,1-b][1,3]thiazol-5-amine |
|---|---|
| PubChem CID | 82068723 |
| Molecular Formula | C15H11N5S |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 3,6-dipyridin-4-ylimidazo[2,1-b][1,3]thiazol-5-amine |
| SMILES | Nc1c(-c2ccncc2)nc2scc(-c3ccncc3)n12 |
| InChI | InChI=1S/C15H11N5S/c16-14-13(11-3-7-18-8-4-11)19-15-20(14)12(9-21-15)10-1-5-17-6-2-10/h1-9H,16H2 |
| InChIKey | FFNVQSTYOOGZOI-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |