C19H20N4O3S2 — CID 135543393
N-(4-ethoxyphenyl)-2-[2-[(5-methylthiophen-2-yl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetamide (PubChem CID 135543393) has the molecular formula C19H20N4O3S2 and a molecular weight of 416.53 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-2-[2-[(5-methylthiophen-2-yl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(4-ethoxyphenyl)-2-[2-[(5-methylthiophen-2-yl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 135543393 |
| Molecular Formula | C19H20N4O3S2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | N-(4-ethoxyphenyl)-2-[2-[(5-methylthiophen-2-yl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetamide |
| SMILES | CCOc1ccc(NC(=O)CC2SC(=NN=Cc3ccc(C)s3)NC2=O)cc1 |
| InChI | InChI=1S/C19H20N4O3S2/c1-3-26-14-7-5-13(6-8-14)21-17(24)10-16-18(25)22-19(28-16)23-20-11-15-9-4-12(2)27-15/h4-9,11,16H,3,10H2,1-2H3,(H,21,24)(H,22,23,25) |
| InChIKey | CAUMDJDWDYAXGC-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|