C15H15ClFN3O3S — CID 135543441
N-(4-chloro-2-fluorophenyl)-2-(4-hydroxy-6-oxo-1-propylpyrimidin-2-yl)sulfanylacetamide (PubChem CID 135543441) has the molecular formula C15H15ClFN3O3S and a molecular weight of 371.82 g/mol. Its IUPAC name is N-(4-chloro-2-fluorophenyl)-2-(4-hydroxy-6-oxo-1-propylpyrimidin-2-yl)sulfanylacetamide.
| Compound Name | N-(4-chloro-2-fluorophenyl)-2-(4-hydroxy-6-oxo-1-propylpyrimidin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 135543441 |
| Molecular Formula | C15H15ClFN3O3S |
| Molecular Weight | 371.82 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | N-(4-chloro-2-fluorophenyl)-2-(4-hydroxy-6-oxo-1-propylpyrimidin-2-yl)sulfanylacetamide |
| SMILES | CCCn1c(SCC(=O)Nc2ccc(Cl)cc2F)nc(O)cc1=O |
| InChI | InChI=1S/C15H15ClFN3O3S/c1-2-5-20-14(23)7-12(21)19-15(20)24-8-13(22)18-11-4-3-9(16)6-10(11)17/h3-4,6-7,21H,2,5,8H2,1H3,(H,18,22) |
| InChIKey | JRDBPVIRGZODCS-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.82 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |