C20H18N2O4S — CID 135546041
ethyl (5Z)-4-hydroxy-2-(4-methoxyphenyl)imino-5-(pyridin-3-ylmethylidene)thiophene-3-carboxylate (PubChem CID 135546041) has the molecular formula C20H18N2O4S and a molecular weight of 382.44 g/mol. Its IUPAC name is ethyl (5Z)-4-hydroxy-2-(4-methoxyphenyl)imino-5-(pyridin-3-ylmethylidene)thiophene-3-carboxylate.
| Compound Name | ethyl (5Z)-4-hydroxy-2-(4-methoxyphenyl)imino-5-(pyridin-3-ylmethylidene)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 135546041 |
| Molecular Formula | C20H18N2O4S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | ethyl (5Z)-4-hydroxy-2-(4-methoxyphenyl)imino-5-(pyridin-3-ylmethylidene)thiophene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)/C(=C/c2cccnc2)S/C1=N\c1ccc(OC)cc1 |
| InChI | InChI=1S/C20H18N2O4S/c1-3-26-20(24)17-18(23)16(11-13-5-4-10-21-12-13)27-19(17)22-14-6-8-15(25-2)9-7-14/h4-12,23H,3H2,1-2H3/b16-11-,22-19- |
| InChIKey | XLHCOLHRMLRECD-FNYIDTNGSA-N |
| XLogP | 4.28 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|