C19H14Cl2N2O3S — CID 135530385
ethyl 2-(2,4-dichlorophenyl)imino-4-hydroxy-5-(pyridin-3-ylmethylidene)thiophene-3-carboxylate (PubChem CID 135530385) has the molecular formula C19H14Cl2N2O3S and a molecular weight of 421.31 g/mol. Its IUPAC name is ethyl 2-(2,4-dichlorophenyl)imino-4-hydroxy-5-(pyridin-3-ylmethylidene)thiophene-3-carboxylate.
| Compound Name | ethyl 2-(2,4-dichlorophenyl)imino-4-hydroxy-5-(pyridin-3-ylmethylidene)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 135530385 |
| Molecular Formula | C19H14Cl2N2O3S |
| Molecular Weight | 421.31 g/mol |
| Exact Mass | 420.01 |
| IUPAC Name | ethyl 2-(2,4-dichlorophenyl)imino-4-hydroxy-5-(pyridin-3-ylmethylidene)thiophene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)C(=Cc2cccnc2)S/C1=N\c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H14Cl2N2O3S/c1-2-26-19(25)16-17(24)15(8-11-4-3-7-22-10-11)27-18(16)23-14-6-5-12(20)9-13(14)21/h3-10,24H,2H2,1H3/b15-8?,23-18- |
| InChIKey | YSLOFHLAMCYHFI-XBJAAPGNSA-N |
| XLogP | 5.58 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.31 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|