C20H15Cl2NO4S — CID 135456928
ethyl 2-(2,4-dichlorophenyl)imino-4-hydroxy-5-[(3-hydroxyphenyl)methylidene]thiophene-3-carboxylate (PubChem CID 135456928) has the molecular formula C20H15Cl2NO4S and a molecular weight of 436.32 g/mol. Its IUPAC name is ethyl 2-(2,4-dichlorophenyl)imino-4-hydroxy-5-[(3-hydroxyphenyl)methylidene]thiophene-3-carboxylate.
| Compound Name | ethyl 2-(2,4-dichlorophenyl)imino-4-hydroxy-5-[(3-hydroxyphenyl)methylidene]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 135456928 |
| Molecular Formula | C20H15Cl2NO4S |
| Molecular Weight | 436.32 g/mol |
| Exact Mass | 435.01 |
| IUPAC Name | ethyl 2-(2,4-dichlorophenyl)imino-4-hydroxy-5-[(3-hydroxyphenyl)methylidene]thiophene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)C(=Cc2cccc(O)c2)S/C1=N\c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H15Cl2NO4S/c1-2-27-20(26)17-18(25)16(9-11-4-3-5-13(24)8-11)28-19(17)23-15-7-6-12(21)10-14(15)22/h3-10,24-25H,2H2,1H3/b16-9?,23-19- |
| InChIKey | WJUIBQQATDASRV-VPQRZLDWSA-N |
| XLogP | 5.89 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.32 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|