C20H16FNO4S — CID 171136098
ethyl 2-(2-fluorophenyl)imino-4-hydroxy-5-[(3-hydroxyphenyl)methylidene]thiophene-3-carboxylate (PubChem CID 171136098) has the molecular formula C20H16FNO4S and a molecular weight of 385.42 g/mol. Its IUPAC name is ethyl 2-(2-fluorophenyl)imino-4-hydroxy-5-[(3-hydroxyphenyl)methylidene]thiophene-3-carboxylate.
| Compound Name | ethyl 2-(2-fluorophenyl)imino-4-hydroxy-5-[(3-hydroxyphenyl)methylidene]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 171136098 |
| Molecular Formula | C20H16FNO4S |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | ethyl 2-(2-fluorophenyl)imino-4-hydroxy-5-[(3-hydroxyphenyl)methylidene]thiophene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)C(=Cc2cccc(O)c2)S/C1=N\c1ccccc1F |
| InChI | InChI=1S/C20H16FNO4S/c1-2-26-20(25)17-18(24)16(11-12-6-5-7-13(23)10-12)27-19(17)22-15-9-4-3-8-14(15)21/h3-11,23-24H,2H2,1H3/b16-11?,22-19- |
| InChIKey | ACQRXNOYXMIFOY-CMXVFSGJSA-N |
| XLogP | 4.72 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|