C15H14N2O4S — CID 135547722
1-[(4-hydroxy-6-methyl-2-oxopyran-3-yl)methylidene]-3-(2-methoxyphenyl)thiourea (PubChem CID 135547722) has the molecular formula C15H14N2O4S and a molecular weight of 318.35 g/mol. Its IUPAC name is 1-[(4-hydroxy-6-methyl-2-oxopyran-3-yl)methylidene]-3-(2-methoxyphenyl)thiourea.
| Compound Name | 1-[(4-hydroxy-6-methyl-2-oxopyran-3-yl)methylidene]-3-(2-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 135547722 |
| Molecular Formula | C15H14N2O4S |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 1-[(4-hydroxy-6-methyl-2-oxopyran-3-yl)methylidene]-3-(2-methoxyphenyl)thiourea |
| SMILES | COc1ccccc1NC(=S)N=Cc1c(O)cc(C)oc1=O |
| InChI | InChI=1S/C15H14N2O4S/c1-9-7-12(18)10(14(19)21-9)8-16-15(22)17-11-5-3-4-6-13(11)20-2/h3-8,18H,1-2H3,(H,17,22) |
| InChIKey | AFBMSTZGOAVNCM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|