C27H28N6O5 — CID 135547944
2-[3-(5-amino-1H-pyrrolo[3,2-b]pyridin-2-yl)-4-hydroxy-5-(3-nitrophenyl)phenyl]-N-(2-morpholin-4-ylethyl)acetamide (PubChem CID 135547944) has the molecular formula C27H28N6O5 and a molecular weight of 516.56 g/mol. Its IUPAC name is 2-[3-(5-amino-1H-pyrrolo[3,2-b]pyridin-2-yl)-4-hydroxy-5-(3-nitrophenyl)phenyl]-N-(2-morpholin-4-ylethyl)acetamide.
| Compound Name | 2-[3-(5-amino-1H-pyrrolo[3,2-b]pyridin-2-yl)-4-hydroxy-5-(3-nitrophenyl)phenyl]-N-(2-morpholin-4-ylethyl)acetamide |
|---|---|
| PubChem CID | 135547944 |
| Molecular Formula | C27H28N6O5 |
| Molecular Weight | 516.56 g/mol |
| Exact Mass | 516.21 |
| IUPAC Name | 2-[3-(5-amino-1H-pyrrolo[3,2-b]pyridin-2-yl)-4-hydroxy-5-(3-nitrophenyl)phenyl]-N-(2-morpholin-4-ylethyl)acetamide |
| SMILES | Nc1ccc2[nH]c(-c3cc(CC(=O)NCCN4CCOCC4)cc(-c4cccc([N+](=O)[O-])c4)c3O)cc2n1 |
| InChI | InChI=1S/C27H28N6O5/c28-25-5-4-22-24(31-25)16-23(30-22)21-13-17(14-26(34)29-6-7-32-8-10-38-11-9-32)12-20(27(21)35)18-2-1-3-19(15-18)33(36)37/h1-5,12-13,15-16,30,35H,6-11,14H2,(H2,28,31)(H,29,34) |
| InChIKey | PHYOILHHMRQBIE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 159.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.56 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|