C30H28MnN4O6 — CID 135548281
bis(1-[3-(furan-2-yl)-5-(2-hydroxyphenyl)-3,4-dihydropyrazol-2-yl]ethanone);manganese (PubChem CID 135548281) has the molecular formula C30H28MnN4O6 and a molecular weight of 595.51 g/mol. Its IUPAC name is bis(1-[3-(furan-2-yl)-5-(2-hydroxyphenyl)-3,4-dihydropyrazol-2-yl]ethanone);manganese.
| Compound Name | bis(1-[3-(furan-2-yl)-5-(2-hydroxyphenyl)-3,4-dihydropyrazol-2-yl]ethanone);manganese |
|---|---|
| PubChem CID | 135548281 |
| Molecular Formula | C30H28MnN4O6 |
| Molecular Weight | 595.51 g/mol |
| Exact Mass | 595.14 |
| IUPAC Name | bis(1-[3-(furan-2-yl)-5-(2-hydroxyphenyl)-3,4-dihydropyrazol-2-yl]ethanone);manganese |
| SMILES | CC(=O)N1N=C(c2ccccc2O)CC1c1ccco1.CC(=O)N1N=C(c2ccccc2O)CC1c1ccco1.[Mn] |
| InChI | InChI=1S/2C15H14N2O3.Mn/c2*1-10(18)17-13(15-7-4-8-20-15)9-12(16-17)11-5-2-3-6-14(11)19;/h2*2-8,13,19H,9H2,1H3; |
| InChIKey | PEUXDYHGFWQYMV-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 132.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.51 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'} |
|---|