C21H23CaN7O7 — CID 135549407
calcium (2S)-2-[[4-[[(6R)-2-amino-5-formyl-4-oxo-3,6,7,8-tetrahydropteridin-6-yl]methylamino]benzoyl]amino]hexanedioate (PubChem CID 135549407) has the molecular formula C21H23CaN7O7 and a molecular weight of 525.54 g/mol. Its IUPAC name is calcium (2S)-2-[[4-[[(6R)-2-amino-5-formyl-4-oxo-3,6,7,8-tetrahydropteridin-6-yl]methylamino]benzoyl]amino]hexanedioate.
| Compound Name | calcium (2S)-2-[[4-[[(6R)-2-amino-5-formyl-4-oxo-3,6,7,8-tetrahydropteridin-6-yl]methylamino]benzoyl]amino]hexanedioate |
|---|---|
| PubChem CID | 135549407 |
| Molecular Formula | C21H23CaN7O7 |
| Molecular Weight | 525.54 g/mol |
| Exact Mass | 525.13 |
| IUPAC Name | calcium (2S)-2-[[4-[[(6R)-2-amino-5-formyl-4-oxo-3,6,7,8-tetrahydropteridin-6-yl]methylamino]benzoyl]amino]hexanedioate |
| SMILES | Nc1nc2c(c(=O)[nH]1)N(C=O)[C@H](CNc1ccc(C(=O)N[C@@H](CCCC(=O)[O-])C(=O)[O-])cc1)CN2.[Ca+2] |
| InChI | InChI=1S/C21H25N7O7.Ca/c22-21-26-17-16(19(33)27-21)28(10-29)13(9-24-17)8-23-12-6-4-11(5-7-12)18(32)25-14(20(34)35)2-1-3-15(30)31;/h4-7,10,13-14,23H,1-3,8-9H2,(H,25,32)(H,30,31)(H,34,35)(H4,22,24,26,27,33);/q;+2/p-2/t13-,14+;/m1./s1 |
| InChIKey | WBLGSPHVSAZTHQ-DFQHDRSWSA-L |
| XLogP | -3.39 |
| TPSA | 225.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.54 |
| LogP ≤ 5 | -3.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|