C20H23CaN7O6 — CID 136961198
calcium (2S)-2-[[4-[(2-amino-5-methyl-4-oxo-3,6,7,8-tetrahydropteridin-6-yl)methylamino]benzoyl]amino](1,2,3,4,5-13C5)pentanedioate (PubChem CID 136961198) has the molecular formula C20H23CaN7O6 and a molecular weight of 502.49 g/mol. Its IUPAC name is calcium (2S)-2-[[4-[(2-amino-5-methyl-4-oxo-3,6,7,8-tetrahydropteridin-6-yl)methylamino]benzoyl]amino](1,2,3,4,5-13C5)pentanedioate.
| Compound Name | calcium (2S)-2-[[4-[(2-amino-5-methyl-4-oxo-3,6,7,8-tetrahydropteridin-6-yl)methylamino]benzoyl]amino](1,2,3,4,5-13C5)pentanedioate |
|---|---|
| PubChem CID | 136961198 |
| Molecular Formula | C20H23CaN7O6 |
| Molecular Weight | 502.49 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | calcium (2S)-2-[[4-[(2-amino-5-methyl-4-oxo-3,6,7,8-tetrahydropteridin-6-yl)methylamino]benzoyl]amino](1,2,3,4,5-13C5)pentanedioate |
| SMILES | CN1c2c(nc(N)[nH]c2=O)NCC1CNc1ccc(C(=O)N[13C@@H]([13CH2][13CH2][13C](=O)[O-])[13C](=O)[O-])cc1.[Ca+2] |
| InChI | InChI=1S/C20H25N7O6.Ca/c1-27-12(9-23-16-15(27)18(31)26-20(21)25-16)8-22-11-4-2-10(3-5-11)17(30)24-13(19(32)33)6-7-14(28)29;/h2-5,12-13,22H,6-9H2,1H3,(H,24,30)(H,28,29)(H,32,33)(H4,21,23,25,26,31);/q;+2/p-2/t12?,13-;/m0./s1/i6+1,7+1,13+1,14+1,19+1; |
| InChIKey | VWBBRFHSPXRJQD-LALGMWLBSA-L |
| XLogP | -3.31 |
| TPSA | 208.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.49 |
| LogP ≤ 5 | -3.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |