C13H12BrN3O4S — CID 135549954
ethyl (2E)-2-[(E)-(5-bromo-2-hydroxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidine-5-carboxylate (PubChem CID 135549954) has the molecular formula C13H12BrN3O4S and a molecular weight of 386.23 g/mol. Its IUPAC name is ethyl (2E)-2-[(E)-(5-bromo-2-hydroxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidine-5-carboxylate.
| Compound Name | ethyl (2E)-2-[(E)-(5-bromo-2-hydroxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidine-5-carboxylate |
|---|---|
| PubChem CID | 135549954 |
| Molecular Formula | C13H12BrN3O4S |
| Molecular Weight | 386.23 g/mol |
| Exact Mass | 384.97 |
| IUPAC Name | ethyl (2E)-2-[(E)-(5-bromo-2-hydroxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidine-5-carboxylate |
| SMILES | CCOC(=O)C1S/C(=N/N=C/c2cc(Br)ccc2O)NC1=O |
| InChI | InChI=1S/C13H12BrN3O4S/c1-2-21-12(20)10-11(19)16-13(22-10)17-15-6-7-5-8(14)3-4-9(7)18/h3-6,10,18H,2H2,1H3,(H,16,17,19)/b15-6+ |
| InChIKey | NDORFKDGWBNENG-GIDUJCDVSA-N |
| XLogP | 1.64 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.23 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|