C13H11BrN3O5S- — CID 135562474
2-[(2Z,5R)-2-[(E)-(5-bromo-2-hydroxy-3-methoxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetate (PubChem CID 135562474) has the molecular formula C13H11BrN3O5S- and a molecular weight of 401.22 g/mol. Its IUPAC name is 2-[(2Z,5R)-2-[(E)-(5-bromo-2-hydroxy-3-methoxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetate.
| Compound Name | 2-[(2Z,5R)-2-[(E)-(5-bromo-2-hydroxy-3-methoxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetate |
|---|---|
| PubChem CID | 135562474 |
| Molecular Formula | C13H11BrN3O5S- |
| Molecular Weight | 401.22 g/mol |
| Exact Mass | 399.96 |
| IUPAC Name | 2-[(2Z,5R)-2-[(E)-(5-bromo-2-hydroxy-3-methoxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetate |
| SMILES | COc1cc(Br)cc(/C=N/N=C2/NC(=O)[C@@H](CC(=O)[O-])S2)c1O |
| InChI | InChI=1S/C13H12BrN3O5S/c1-22-8-3-7(14)2-6(11(8)20)5-15-17-13-16-12(21)9(23-13)4-10(18)19/h2-3,5,9,20H,4H2,1H3,(H,18,19)(H,16,17,21)/p-1/b15-5+/t9-/m1/s1 |
| InChIKey | HHGIMSYDXRHAGX-DXLPTXHLSA-M |
| XLogP | 0.22 |
| TPSA | 123.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.22 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|