C16H17F3N4O4 — CID 135550125
methyl (5S,6R,7R)-5-hydroxy-7-(3-methoxyphenyl)-5-methyl-2-(trifluoromethyl)-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 135550125) has the molecular formula C16H17F3N4O4 and a molecular weight of 386.33 g/mol. Its IUPAC name is methyl (5S,6R,7R)-5-hydroxy-7-(3-methoxyphenyl)-5-methyl-2-(trifluoromethyl)-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | methyl (5S,6R,7R)-5-hydroxy-7-(3-methoxyphenyl)-5-methyl-2-(trifluoromethyl)-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135550125 |
| Molecular Formula | C16H17F3N4O4 |
| Molecular Weight | 386.33 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | methyl (5S,6R,7R)-5-hydroxy-7-(3-methoxyphenyl)-5-methyl-2-(trifluoromethyl)-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@H](c2cccc(OC)c2)n2nc(C(F)(F)F)nc2N[C@@]1(C)O |
| InChI | InChI=1S/C16H17F3N4O4/c1-15(25)10(12(24)27-3)11(8-5-4-6-9(7-8)26-2)23-14(21-15)20-13(22-23)16(17,18)19/h4-7,10-11,25H,1-3H3,(H,20,21,22)/t10-,11-,15-/m0/s1 |
| InChIKey | RCWWWXJEMMRNLB-PGUXBMHVSA-N |
| XLogP | 1.82 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.33 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |