C17H17FN4O — CID 135550601
2-amino-5-fluoro-6-(2-hydroxyphenyl)-4-piperidin-3-ylpyridine-3-carbonitrile (PubChem CID 135550601) has the molecular formula C17H17FN4O and a molecular weight of 312.35 g/mol. Its IUPAC name is 2-amino-5-fluoro-6-(2-hydroxyphenyl)-4-piperidin-3-ylpyridine-3-carbonitrile.
| Compound Name | 2-amino-5-fluoro-6-(2-hydroxyphenyl)-4-piperidin-3-ylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 135550601 |
| Molecular Formula | C17H17FN4O |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 2-amino-5-fluoro-6-(2-hydroxyphenyl)-4-piperidin-3-ylpyridine-3-carbonitrile |
| SMILES | N#Cc1c(N)nc(-c2ccccc2O)c(F)c1C1CCCNC1 |
| InChI | InChI=1S/C17H17FN4O/c18-15-14(10-4-3-7-21-9-10)12(8-19)17(20)22-16(15)11-5-1-2-6-13(11)23/h1-2,5-6,10,21,23H,3-4,7,9H2,(H2,20,22) |
| InChIKey | XYNCCQCQBYXZIL-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 94.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |