C16H16FN5O — CID 143039304
4-amino-2-(5-fluoro-2-hydroxyphenyl)-6-piperidin-3-ylpyrimidine-5-carbonitrile (PubChem CID 143039304) has the molecular formula C16H16FN5O and a molecular weight of 313.34 g/mol. Its IUPAC name is 4-amino-2-(5-fluoro-2-hydroxyphenyl)-6-piperidin-3-ylpyrimidine-5-carbonitrile.
| Compound Name | 4-amino-2-(5-fluoro-2-hydroxyphenyl)-6-piperidin-3-ylpyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 143039304 |
| Molecular Formula | C16H16FN5O |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 4-amino-2-(5-fluoro-2-hydroxyphenyl)-6-piperidin-3-ylpyrimidine-5-carbonitrile |
| SMILES | N#Cc1c(N)nc(-c2cc(F)ccc2O)nc1C1CCCNC1 |
| InChI | InChI=1S/C16H16FN5O/c17-10-3-4-13(23)11(6-10)16-21-14(9-2-1-5-20-8-9)12(7-18)15(19)22-16/h3-4,6,9,20,23H,1-2,5,8H2,(H2,19,21,22) |
| InChIKey | HZHIHGDSQFTJOL-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 107.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |