C19H22N2O2S2 — CID 135550824
methyl N-[2-[(4-methoxyphenyl)methylsulfanyl]propanoyl]-N'-phenylcarbamimidothioate (PubChem CID 135550824) has the molecular formula C19H22N2O2S2 and a molecular weight of 374.53 g/mol. Its IUPAC name is methyl N-[2-[(4-methoxyphenyl)methylsulfanyl]propanoyl]-N'-phenylcarbamimidothioate.
| Compound Name | methyl N-[2-[(4-methoxyphenyl)methylsulfanyl]propanoyl]-N'-phenylcarbamimidothioate |
|---|---|
| PubChem CID | 135550824 |
| Molecular Formula | C19H22N2O2S2 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | methyl N-[2-[(4-methoxyphenyl)methylsulfanyl]propanoyl]-N'-phenylcarbamimidothioate |
| SMILES | COc1ccc(CSC(C)C(=O)N/C(=N/c2ccccc2)SC)cc1 |
| InChI | InChI=1S/C19H22N2O2S2/c1-14(25-13-15-9-11-17(23-2)12-10-15)18(22)21-19(24-3)20-16-7-5-4-6-8-16/h4-12,14H,13H2,1-3H3,(H,20,21,22) |
| InChIKey | QUGMGUUGQHAFGB-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|