C18H16N6O4 — CID 135551869
N-[5-methyl-2-(4-oxo-3,5,6,7-tetrahydrocyclopenta[d]pyrimidin-2-yl)pyrazol-3-yl]-3-nitrobenzamide (PubChem CID 135551869) has the molecular formula C18H16N6O4 and a molecular weight of 380.36 g/mol. Its IUPAC name is N-[5-methyl-2-(4-oxo-3,5,6,7-tetrahydrocyclopenta[d]pyrimidin-2-yl)pyrazol-3-yl]-3-nitrobenzamide.
| Compound Name | N-[5-methyl-2-(4-oxo-3,5,6,7-tetrahydrocyclopenta[d]pyrimidin-2-yl)pyrazol-3-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 135551869 |
| Molecular Formula | C18H16N6O4 |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | N-[5-methyl-2-(4-oxo-3,5,6,7-tetrahydrocyclopenta[d]pyrimidin-2-yl)pyrazol-3-yl]-3-nitrobenzamide |
| SMILES | Cc1cc(NC(=O)c2cccc([N+](=O)[O-])c2)n(-c2nc3c(c(=O)[nH]2)CCC3)n1 |
| InChI | InChI=1S/C18H16N6O4/c1-10-8-15(20-16(25)11-4-2-5-12(9-11)24(27)28)23(22-10)18-19-14-7-3-6-13(14)17(26)21-18/h2,4-5,8-9H,3,6-7H2,1H3,(H,20,25)(H,19,21,26) |
| InChIKey | QUIVSAIOLKCJER-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 135.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|