C18H15ClN6O4 — CID 135551877
4-chloro-N-[5-methyl-2-(4-oxo-3,5,6,7-tetrahydrocyclopenta[d]pyrimidin-2-yl)pyrazol-3-yl]-3-nitrobenzamide (PubChem CID 135551877) has the molecular formula C18H15ClN6O4 and a molecular weight of 414.81 g/mol. Its IUPAC name is 4-chloro-N-[5-methyl-2-(4-oxo-3,5,6,7-tetrahydrocyclopenta[d]pyrimidin-2-yl)pyrazol-3-yl]-3-nitrobenzamide.
| Compound Name | 4-chloro-N-[5-methyl-2-(4-oxo-3,5,6,7-tetrahydrocyclopenta[d]pyrimidin-2-yl)pyrazol-3-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 135551877 |
| Molecular Formula | C18H15ClN6O4 |
| Molecular Weight | 414.81 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | 4-chloro-N-[5-methyl-2-(4-oxo-3,5,6,7-tetrahydrocyclopenta[d]pyrimidin-2-yl)pyrazol-3-yl]-3-nitrobenzamide |
| SMILES | Cc1cc(NC(=O)c2ccc(Cl)c([N+](=O)[O-])c2)n(-c2nc3c(c(=O)[nH]2)CCC3)n1 |
| InChI | InChI=1S/C18H15ClN6O4/c1-9-7-15(21-16(26)10-5-6-12(19)14(8-10)25(28)29)24(23-9)18-20-13-4-2-3-11(13)17(27)22-18/h5-8H,2-4H2,1H3,(H,21,26)(H,20,22,27) |
| InChIKey | OGLFZQGJHGOGMM-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 135.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.81 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|