C20H15ClN6O4S — CID 136605198
4-chloro-N-[1-(4,5-dimethyl-6-oxo-1H-pyrimidin-2-yl)-3-thiophen-2-ylpyrazol-5-yl]-3-nitrobenzamide (PubChem CID 136605198) has the molecular formula C20H15ClN6O4S and a molecular weight of 470.90 g/mol. Its IUPAC name is 4-chloro-N-[1-(4,5-dimethyl-6-oxo-1H-pyrimidin-2-yl)-3-thiophen-2-ylpyrazol-5-yl]-3-nitrobenzamide.
| Compound Name | 4-chloro-N-[1-(4,5-dimethyl-6-oxo-1H-pyrimidin-2-yl)-3-thiophen-2-ylpyrazol-5-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 136605198 |
| Molecular Formula | C20H15ClN6O4S |
| Molecular Weight | 470.90 g/mol |
| Exact Mass | 470.06 |
| IUPAC Name | 4-chloro-N-[1-(4,5-dimethyl-6-oxo-1H-pyrimidin-2-yl)-3-thiophen-2-ylpyrazol-5-yl]-3-nitrobenzamide |
| SMILES | Cc1nc(-n2nc(-c3cccs3)cc2NC(=O)c2ccc(Cl)c([N+](=O)[O-])c2)[nH]c(=O)c1C |
| InChI | InChI=1S/C20H15ClN6O4S/c1-10-11(2)22-20(24-18(10)28)26-17(9-14(25-26)16-4-3-7-32-16)23-19(29)12-5-6-13(21)15(8-12)27(30)31/h3-9H,1-2H3,(H,23,29)(H,22,24,28) |
| InChIKey | VOZLZNIPLVFJQL-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 135.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.90 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|