C22H17ClN6O4S — CID 136606038
2-chloro-5-nitro-N-[1-(4-oxo-5,6,7,8-tetrahydro-3H-quinazolin-2-yl)-3-thiophen-2-ylpyrazol-5-yl]benzamide (PubChem CID 136606038) has the molecular formula C22H17ClN6O4S and a molecular weight of 496.94 g/mol. Its IUPAC name is 2-chloro-5-nitro-N-[1-(4-oxo-5,6,7,8-tetrahydro-3H-quinazolin-2-yl)-3-thiophen-2-ylpyrazol-5-yl]benzamide.
| Compound Name | 2-chloro-5-nitro-N-[1-(4-oxo-5,6,7,8-tetrahydro-3H-quinazolin-2-yl)-3-thiophen-2-ylpyrazol-5-yl]benzamide |
|---|---|
| PubChem CID | 136606038 |
| Molecular Formula | C22H17ClN6O4S |
| Molecular Weight | 496.94 g/mol |
| Exact Mass | 496.07 |
| IUPAC Name | 2-chloro-5-nitro-N-[1-(4-oxo-5,6,7,8-tetrahydro-3H-quinazolin-2-yl)-3-thiophen-2-ylpyrazol-5-yl]benzamide |
| SMILES | O=C(Nc1cc(-c2cccs2)nn1-c1nc2c(c(=O)[nH]1)CCCC2)c1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C22H17ClN6O4S/c23-15-8-7-12(29(32)33)10-14(15)21(31)25-19-11-17(18-6-3-9-34-18)27-28(19)22-24-16-5-2-1-4-13(16)20(30)26-22/h3,6-11H,1-2,4-5H2,(H,25,31)(H,24,26,30) |
| InChIKey | GEYVOFRVTLAGCK-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 135.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.94 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|