C19H20ClN5O2S — CID 136605991
4-chloro-N-[1-(4-oxo-5,6,7,8-tetrahydro-3H-quinazolin-2-yl)-3-thiophen-2-ylpyrazol-5-yl]butanamide (PubChem CID 136605991) has the molecular formula C19H20ClN5O2S and a molecular weight of 417.92 g/mol. Its IUPAC name is 4-chloro-N-[1-(4-oxo-5,6,7,8-tetrahydro-3H-quinazolin-2-yl)-3-thiophen-2-ylpyrazol-5-yl]butanamide.
| Compound Name | 4-chloro-N-[1-(4-oxo-5,6,7,8-tetrahydro-3H-quinazolin-2-yl)-3-thiophen-2-ylpyrazol-5-yl]butanamide |
|---|---|
| PubChem CID | 136605991 |
| Molecular Formula | C19H20ClN5O2S |
| Molecular Weight | 417.92 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | 4-chloro-N-[1-(4-oxo-5,6,7,8-tetrahydro-3H-quinazolin-2-yl)-3-thiophen-2-ylpyrazol-5-yl]butanamide |
| SMILES | O=C(CCCCl)Nc1cc(-c2cccs2)nn1-c1nc2c(c(=O)[nH]1)CCCC2 |
| InChI | InChI=1S/C19H20ClN5O2S/c20-9-3-8-17(26)22-16-11-14(15-7-4-10-28-15)24-25(16)19-21-13-6-2-1-5-12(13)18(27)23-19/h4,7,10-11H,1-3,5-6,8-9H2,(H,22,26)(H,21,23,27) |
| InChIKey | LWKMZVZWQGBOAP-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.92 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|