C21H18N6O4S — CID 136605218
N-[1-(4,5-dimethyl-6-oxo-1H-pyrimidin-2-yl)-3-thiophen-2-ylpyrazol-5-yl]-2-(4-nitrophenyl)acetamide (PubChem CID 136605218) has the molecular formula C21H18N6O4S and a molecular weight of 450.48 g/mol. Its IUPAC name is N-[1-(4,5-dimethyl-6-oxo-1H-pyrimidin-2-yl)-3-thiophen-2-ylpyrazol-5-yl]-2-(4-nitrophenyl)acetamide.
| Compound Name | N-[1-(4,5-dimethyl-6-oxo-1H-pyrimidin-2-yl)-3-thiophen-2-ylpyrazol-5-yl]-2-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 136605218 |
| Molecular Formula | C21H18N6O4S |
| Molecular Weight | 450.48 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | N-[1-(4,5-dimethyl-6-oxo-1H-pyrimidin-2-yl)-3-thiophen-2-ylpyrazol-5-yl]-2-(4-nitrophenyl)acetamide |
| SMILES | Cc1nc(-n2nc(-c3cccs3)cc2NC(=O)Cc2ccc([N+](=O)[O-])cc2)[nH]c(=O)c1C |
| InChI | InChI=1S/C21H18N6O4S/c1-12-13(2)22-21(24-20(12)29)26-18(11-16(25-26)17-4-3-9-32-17)23-19(28)10-14-5-7-15(8-6-14)27(30)31/h3-9,11H,10H2,1-2H3,(H,23,28)(H,22,24,29) |
| InChIKey | ASQGIFFKSGSHJV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 135.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.48 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|