C25H18N6O4S — CID 136605466
4-methyl-3-nitro-N-[1-(6-oxo-4-phenyl-1H-pyrimidin-2-yl)-3-thiophen-2-ylpyrazol-5-yl]benzamide (PubChem CID 136605466) has the molecular formula C25H18N6O4S and a molecular weight of 498.52 g/mol. Its IUPAC name is 4-methyl-3-nitro-N-[1-(6-oxo-4-phenyl-1H-pyrimidin-2-yl)-3-thiophen-2-ylpyrazol-5-yl]benzamide.
| Compound Name | 4-methyl-3-nitro-N-[1-(6-oxo-4-phenyl-1H-pyrimidin-2-yl)-3-thiophen-2-ylpyrazol-5-yl]benzamide |
|---|---|
| PubChem CID | 136605466 |
| Molecular Formula | C25H18N6O4S |
| Molecular Weight | 498.52 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | 4-methyl-3-nitro-N-[1-(6-oxo-4-phenyl-1H-pyrimidin-2-yl)-3-thiophen-2-ylpyrazol-5-yl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2cc(-c3cccs3)nn2-c2nc(-c3ccccc3)cc(=O)[nH]2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H18N6O4S/c1-15-9-10-17(12-20(15)31(34)35)24(33)27-22-13-19(21-8-5-11-36-21)29-30(22)25-26-18(14-23(32)28-25)16-6-3-2-4-7-16/h2-14H,1H3,(H,27,33)(H,26,28,32) |
| InChIKey | PTSIHIDOYMIKAJ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 135.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.52 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|