C19H14ClN5O2S — CID 136605422
2-chloro-N-[1-(6-oxo-4-phenyl-1H-pyrimidin-2-yl)-3-thiophen-2-ylpyrazol-5-yl]acetamide (PubChem CID 136605422) has the molecular formula C19H14ClN5O2S and a molecular weight of 411.87 g/mol. Its IUPAC name is 2-chloro-N-[1-(6-oxo-4-phenyl-1H-pyrimidin-2-yl)-3-thiophen-2-ylpyrazol-5-yl]acetamide.
| Compound Name | 2-chloro-N-[1-(6-oxo-4-phenyl-1H-pyrimidin-2-yl)-3-thiophen-2-ylpyrazol-5-yl]acetamide |
|---|---|
| PubChem CID | 136605422 |
| Molecular Formula | C19H14ClN5O2S |
| Molecular Weight | 411.87 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | 2-chloro-N-[1-(6-oxo-4-phenyl-1H-pyrimidin-2-yl)-3-thiophen-2-ylpyrazol-5-yl]acetamide |
| SMILES | O=C(CCl)Nc1cc(-c2cccs2)nn1-c1nc(-c2ccccc2)cc(=O)[nH]1 |
| InChI | InChI=1S/C19H14ClN5O2S/c20-11-18(27)22-16-9-14(15-7-4-8-28-15)24-25(16)19-21-13(10-17(26)23-19)12-5-2-1-3-6-12/h1-10H,11H2,(H,22,27)(H,21,23,26) |
| InChIKey | AYJSWMLMYNNFRG-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.87 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|