C23H22Cl2N4O4 — CID 135558191
N-[(4R,5S)-4-(3,4-dichlorophenyl)-1,3-dimethyl-6-oxo-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-5-yl]-3,4-dimethoxybenzamide (PubChem CID 135558191) has the molecular formula C23H22Cl2N4O4 and a molecular weight of 489.36 g/mol. Its IUPAC name is N-[(4R,5S)-4-(3,4-dichlorophenyl)-1,3-dimethyl-6-oxo-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-5-yl]-3,4-dimethoxybenzamide.
| Compound Name | N-[(4R,5S)-4-(3,4-dichlorophenyl)-1,3-dimethyl-6-oxo-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-5-yl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 135558191 |
| Molecular Formula | C23H22Cl2N4O4 |
| Molecular Weight | 489.36 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | N-[(4R,5S)-4-(3,4-dichlorophenyl)-1,3-dimethyl-6-oxo-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-5-yl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)N[C@@H]2C(=O)Nc3c(c(C)nn3C)[C@H]2c2ccc(Cl)c(Cl)c2)cc1OC |
| InChI | InChI=1S/C23H22Cl2N4O4/c1-11-18-19(12-5-7-14(24)15(25)9-12)20(23(31)27-21(18)29(2)28-11)26-22(30)13-6-8-16(32-3)17(10-13)33-4/h5-10,19-20H,1-4H3,(H,26,30)(H,27,31)/t19-,20+/m1/s1 |
| InChIKey | PGIWPEVINZXEAK-UXHICEINSA-N |
| XLogP | 3.94 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.36 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |