C26H30N4O5 — CID 135760787
N-[(4R,5S)-4-(4-ethylphenyl)-1,3-dimethyl-6-oxo-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-5-yl]-3,4,5-trimethoxybenzamide (PubChem CID 135760787) has the molecular formula C26H30N4O5 and a molecular weight of 478.55 g/mol. Its IUPAC name is N-[(4R,5S)-4-(4-ethylphenyl)-1,3-dimethyl-6-oxo-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-5-yl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[(4R,5S)-4-(4-ethylphenyl)-1,3-dimethyl-6-oxo-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-5-yl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 135760787 |
| Molecular Formula | C26H30N4O5 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | N-[(4R,5S)-4-(4-ethylphenyl)-1,3-dimethyl-6-oxo-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-5-yl]-3,4,5-trimethoxybenzamide |
| SMILES | CCc1ccc([C@@H]2c3c(C)nn(C)c3NC(=O)[C@H]2NC(=O)c2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C26H30N4O5/c1-7-15-8-10-16(11-9-15)21-20-14(2)29-30(3)24(20)28-26(32)22(21)27-25(31)17-12-18(33-4)23(35-6)19(13-17)34-5/h8-13,21-22H,7H2,1-6H3,(H,27,31)(H,28,32)/t21-,22+/m1/s1 |
| InChIKey | XEARYEGMAUWANV-YADHBBJMSA-N |
| XLogP | 3.20 |
| TPSA | 103.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |