C13H12F5N3O3 — CID 135562153
ethyl 2-[3-methyl-6-oxo-4-(1,1,2,2,2-pentafluoroethyl)-7H-pyrazolo[5,4-b]pyridin-1-yl]acetate (PubChem CID 135562153) has the molecular formula C13H12F5N3O3 and a molecular weight of 353.25 g/mol. Its IUPAC name is ethyl 2-[3-methyl-6-oxo-4-(1,1,2,2,2-pentafluoroethyl)-7H-pyrazolo[5,4-b]pyridin-1-yl]acetate.
| Compound Name | ethyl 2-[3-methyl-6-oxo-4-(1,1,2,2,2-pentafluoroethyl)-7H-pyrazolo[5,4-b]pyridin-1-yl]acetate |
|---|---|
| PubChem CID | 135562153 |
| Molecular Formula | C13H12F5N3O3 |
| Molecular Weight | 353.25 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | ethyl 2-[3-methyl-6-oxo-4-(1,1,2,2,2-pentafluoroethyl)-7H-pyrazolo[5,4-b]pyridin-1-yl]acetate |
| SMILES | CCOC(=O)Cn1nc(C)c2c(C(F)(F)C(F)(F)F)cc(=O)[nH]c21 |
| InChI | InChI=1S/C13H12F5N3O3/c1-3-24-9(23)5-21-11-10(6(2)20-21)7(4-8(22)19-11)12(14,15)13(16,17)18/h4H,3,5H2,1-2H3,(H,19,22) |
| InChIKey | PGWMOEPVCNMJEE-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.25 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|