C16H13FN4O3 — CID 135562769
7-[(3-fluorophenyl)methyl-methylamino]-6-nitro-3H-quinazolin-4-one (PubChem CID 135562769) has the molecular formula C16H13FN4O3 and a molecular weight of 328.30 g/mol. Its IUPAC name is 7-[(3-fluorophenyl)methyl-methylamino]-6-nitro-3H-quinazolin-4-one.
| Compound Name | 7-[(3-fluorophenyl)methyl-methylamino]-6-nitro-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135562769 |
| Molecular Formula | C16H13FN4O3 |
| Molecular Weight | 328.30 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 7-[(3-fluorophenyl)methyl-methylamino]-6-nitro-3H-quinazolin-4-one |
| SMILES | CN(Cc1cccc(F)c1)c1cc2nc[nH]c(=O)c2cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H13FN4O3/c1-20(8-10-3-2-4-11(17)5-10)14-7-13-12(6-15(14)21(23)24)16(22)19-9-18-13/h2-7,9H,8H2,1H3,(H,18,19,22) |
| InChIKey | NTAMKZNVIHOPSW-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 92.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.30 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|