C11H14O4 — CID 135563708
6-[(E)-4-hydroxybut-2-en-2-yl]-4-methoxy-3-methylpyran-2-one (PubChem CID 135563708) has the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. Its IUPAC name is 6-[(E)-4-hydroxybut-2-en-2-yl]-4-methoxy-3-methylpyran-2-one.
| Compound Name | 6-[(E)-4-hydroxybut-2-en-2-yl]-4-methoxy-3-methylpyran-2-one |
|---|---|
| PubChem CID | 135563708 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 6-[(E)-4-hydroxybut-2-en-2-yl]-4-methoxy-3-methylpyran-2-one |
| SMILES | COc1cc(/C(C)=C/CO)oc(=O)c1C |
| InChI | InChI=1S/C11H14O4/c1-7(4-5-12)9-6-10(14-3)8(2)11(13)15-9/h4,6,12H,5H2,1-3H3/b7-4+ |
| InChIKey | DDLZRFCVVWLJQN-QPJJXVBHSA-N |
| XLogP | 1.35 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |