C8H10O2 — CID 135563809
2,4,5-trideuterio-6-methoxy-3-methylphenol (PubChem CID 135563809) has the molecular formula C8H10O2 and a molecular weight of 141.18 g/mol. Its IUPAC name is 2,4,5-trideuterio-6-methoxy-3-methylphenol.
| Compound Name | 2,4,5-trideuterio-6-methoxy-3-methylphenol |
|---|---|
| PubChem CID | 135563809 |
| Molecular Formula | C8H10O2 |
| Molecular Weight | 141.18 g/mol |
| Exact Mass | 141.09 |
| IUPAC Name | 2,4,5-trideuterio-6-methoxy-3-methylphenol |
| SMILES | [2H]c1c([2H])c(OC)c(O)c([2H])c1C |
| InChI | InChI=1S/C8H10O2/c1-6-3-4-8(10-2)7(9)5-6/h3-5,9H,1-2H3/i3D,4D,5D |
| InChIKey | IFNDEOYXGHGERA-QGZYMEECSA-N |
| XLogP | 1.71 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.18 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |