C20H23N3O4S — CID 135564031
ethyl 2-(2-amino-2-oxoethyl)sulfanyl-6-morpholin-4-yl-4-phenylpyridine-3-carboxylate (PubChem CID 135564031) has the molecular formula C20H23N3O4S and a molecular weight of 401.49 g/mol. Its IUPAC name is ethyl 2-(2-amino-2-oxoethyl)sulfanyl-6-morpholin-4-yl-4-phenylpyridine-3-carboxylate.
| Compound Name | ethyl 2-(2-amino-2-oxoethyl)sulfanyl-6-morpholin-4-yl-4-phenylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 135564031 |
| Molecular Formula | C20H23N3O4S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | ethyl 2-(2-amino-2-oxoethyl)sulfanyl-6-morpholin-4-yl-4-phenylpyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)cc(N2CCOCC2)nc1SCC(N)=O |
| InChI | InChI=1S/C20H23N3O4S/c1-2-27-20(25)18-15(14-6-4-3-5-7-14)12-17(23-8-10-26-11-9-23)22-19(18)28-13-16(21)24/h3-7,12H,2,8-11,13H2,1H3,(H2,21,24) |
| InChIKey | PSXYJZPMAFWGMB-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 94.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |