3-hydroxy-3-methylpyrrolidine-1-sulfonyl fluoride

C5H10FNO3S — CID 135564465

IUPAC3-hydroxy-3-methylpyrrolidine-1-sulfonyl fluoride
SMILESCC1(O)CCN(S(=O)(=O)F)C1
InChIInChI=1S/C5H10FNO3S/c1-5(8)2-3-7(4-5)11(6,9)10/h8H,2-4H2,1H3
InChIKeyFRUSVQMXNIKOBT-UHFFFAOYSA-N
MW183.20 g/mol
LogP-0.34
Rot. Bonds1

About 3-hydroxy-3-methylpyrrolidine-1-sulfonyl fluoride

3-hydroxy-3-methylpyrrolidine-1-sulfonyl fluoride (PubChem CID 135564465) has the molecular formula C5H10FNO3S and a molecular weight of 183.20 g/mol. Its IUPAC name is 3-hydroxy-3-methylpyrrolidine-1-sulfonyl fluoride.

Molecular Properties

Compound Name3-hydroxy-3-methylpyrrolidine-1-sulfonyl fluoride
PubChem CID135564465
Molecular FormulaC5H10FNO3S
Molecular Weight183.20 g/mol
Exact Mass183.04
IUPAC Name3-hydroxy-3-methylpyrrolidine-1-sulfonyl fluoride
SMILESCC1(O)CCN(S(=O)(=O)F)C1
InChIInChI=1S/C5H10FNO3S/c1-5(8)2-3-7(4-5)11(6,9)10/h8H,2-4H2,1H3
InChIKeyFRUSVQMXNIKOBT-UHFFFAOYSA-N
XLogP-0.34
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500183.20
LogP ≤ 5-0.34
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-hydroxy-3-methylpyrrolidine-1-sulfonyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-hydroxy-3-methylpyrrolidine-1-sulfonyl fluoride?
The IUPAC name of 3-hydroxy-3-methylpyrrolidine-1-sulfonyl fluoride (CID 135564465) is 3-hydroxy-3-methylpyrrolidine-1-sulfonyl fluoride.
What is the SMILES notation for 3-hydroxy-3-methylpyrrolidine-1-sulfonyl fluoride?
The canonical SMILES for 3-hydroxy-3-methylpyrrolidine-1-sulfonyl fluoride is CC1(O)CCN(S(=O)(=O)F)C1.
What is the InChIKey of 3-hydroxy-3-methylpyrrolidine-1-sulfonyl fluoride?
The InChIKey is FRUSVQMXNIKOBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10FNO3S/c1-5(8)2-3-7(4-5)11(6,9)10/h8H,2-4H2,1H3.
What are the key properties of 3-hydroxy-3-methylpyrrolidine-1-sulfonyl fluoride?
3-hydroxy-3-methylpyrrolidine-1-sulfonyl fluoride has a molecular weight of 183.20 g/mol, XLogP of -0.34, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-3-methylpyrrolidine-1-sulfonyl fluoride is sourced from PubChem (CID 135564465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).