C5H9F3N2O3S — CID 130161631
3-hydroxy-3-(trifluoromethyl)pyrrolidine-1-sulfonamide (PubChem CID 130161631) has the molecular formula C5H9F3N2O3S and a molecular weight of 234.20 g/mol. Its IUPAC name is 3-hydroxy-3-(trifluoromethyl)pyrrolidine-1-sulfonamide.
| Compound Name | 3-hydroxy-3-(trifluoromethyl)pyrrolidine-1-sulfonamide |
|---|---|
| PubChem CID | 130161631 |
| Molecular Formula | C5H9F3N2O3S |
| Molecular Weight | 234.20 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | 3-hydroxy-3-(trifluoromethyl)pyrrolidine-1-sulfonamide |
| SMILES | NS(=O)(=O)N1CCC(O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C5H9F3N2O3S/c6-5(7,8)4(11)1-2-10(3-4)14(9,12)13/h11H,1-3H2,(H2,9,12,13) |
| InChIKey | SEQLMIYLEDNEQO-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.20 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |