C7H16N2O3S — CID 103871585
3-hydroxy-N,N,3-trimethylpyrrolidine-1-sulfonamide (PubChem CID 103871585) has the molecular formula C7H16N2O3S and a molecular weight of 208.28 g/mol. Its IUPAC name is 3-hydroxy-N,N,3-trimethylpyrrolidine-1-sulfonamide.
| Compound Name | 3-hydroxy-N,N,3-trimethylpyrrolidine-1-sulfonamide |
|---|---|
| PubChem CID | 103871585 |
| Molecular Formula | C7H16N2O3S |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | 3-hydroxy-N,N,3-trimethylpyrrolidine-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CCC(C)(O)C1 |
| InChI | InChI=1S/C7H16N2O3S/c1-7(10)4-5-9(6-7)13(11,12)8(2)3/h10H,4-6H2,1-3H3 |
| InChIKey | YWPKVOVBFKBFGL-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |