C6H10F3NO3S — CID 97217919
(3S)-1-methylsulfonyl-3-(trifluoromethyl)pyrrolidin-3-ol (PubChem CID 97217919) has the molecular formula C6H10F3NO3S and a molecular weight of 233.21 g/mol. Its IUPAC name is (3S)-1-methylsulfonyl-3-(trifluoromethyl)pyrrolidin-3-ol.
| Compound Name | (3S)-1-methylsulfonyl-3-(trifluoromethyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 97217919 |
| Molecular Formula | C6H10F3NO3S |
| Molecular Weight | 233.21 g/mol |
| Exact Mass | 233.03 |
| IUPAC Name | (3S)-1-methylsulfonyl-3-(trifluoromethyl)pyrrolidin-3-ol |
| SMILES | CS(=O)(=O)N1CC[C@@](O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C6H10F3NO3S/c1-14(12,13)10-3-2-5(11,4-10)6(7,8)9/h11H,2-4H2,1H3/t5-/m0/s1 |
| InChIKey | OJRZDYGWEDGTCX-YFKPBYRVSA-N |
| XLogP | -0.05 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.21 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |