C9H16F3NO3S — CID 113356087
3-methyl-1-(4,4,4-trifluorobutylsulfonyl)pyrrolidin-3-ol (PubChem CID 113356087) has the molecular formula C9H16F3NO3S and a molecular weight of 275.29 g/mol. Its IUPAC name is 3-methyl-1-(4,4,4-trifluorobutylsulfonyl)pyrrolidin-3-ol.
| Compound Name | 3-methyl-1-(4,4,4-trifluorobutylsulfonyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 113356087 |
| Molecular Formula | C9H16F3NO3S |
| Molecular Weight | 275.29 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 3-methyl-1-(4,4,4-trifluorobutylsulfonyl)pyrrolidin-3-ol |
| SMILES | CC1(O)CCN(S(=O)(=O)CCCC(F)(F)F)C1 |
| InChI | InChI=1S/C9H16F3NO3S/c1-8(14)4-5-13(7-8)17(15,16)6-2-3-9(10,11)12/h14H,2-7H2,1H3 |
| InChIKey | FIOSIILUXGIKTQ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.29 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |