C9H17F3N2O3S — CID 112737677
1-(1-aminobutan-2-ylsulfonyl)-3-(trifluoromethyl)pyrrolidin-3-ol (PubChem CID 112737677) has the molecular formula C9H17F3N2O3S and a molecular weight of 290.31 g/mol. Its IUPAC name is 1-(1-aminobutan-2-ylsulfonyl)-3-(trifluoromethyl)pyrrolidin-3-ol.
| Compound Name | 1-(1-aminobutan-2-ylsulfonyl)-3-(trifluoromethyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 112737677 |
| Molecular Formula | C9H17F3N2O3S |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 1-(1-aminobutan-2-ylsulfonyl)-3-(trifluoromethyl)pyrrolidin-3-ol |
| SMILES | CCC(CN)S(=O)(=O)N1CCC(O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C9H17F3N2O3S/c1-2-7(5-13)18(16,17)14-4-3-8(15,6-14)9(10,11)12/h7,15H,2-6,13H2,1H3 |
| InChIKey | ASQYPCSLGIGQDL-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |