C8H15F3N2O3S — CID 112737678
1-(1-aminopropan-2-ylsulfonyl)-3-(trifluoromethyl)pyrrolidin-3-ol (PubChem CID 112737678) has the molecular formula C8H15F3N2O3S and a molecular weight of 276.28 g/mol. Its IUPAC name is 1-(1-aminopropan-2-ylsulfonyl)-3-(trifluoromethyl)pyrrolidin-3-ol.
| Compound Name | 1-(1-aminopropan-2-ylsulfonyl)-3-(trifluoromethyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 112737678 |
| Molecular Formula | C8H15F3N2O3S |
| Molecular Weight | 276.28 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 1-(1-aminopropan-2-ylsulfonyl)-3-(trifluoromethyl)pyrrolidin-3-ol |
| SMILES | CC(CN)S(=O)(=O)N1CCC(O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C8H15F3N2O3S/c1-6(4-12)17(15,16)13-3-2-7(14,5-13)8(9,10)11/h6,14H,2-5,12H2,1H3 |
| InChIKey | ICWLFAWAVZHBTM-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.28 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |