C9H16F3NO3S — CID 112737857
1-tert-butylsulfonyl-3-(trifluoromethyl)pyrrolidin-3-ol (PubChem CID 112737857) has the molecular formula C9H16F3NO3S and a molecular weight of 275.29 g/mol. Its IUPAC name is 1-tert-butylsulfonyl-3-(trifluoromethyl)pyrrolidin-3-ol.
| Compound Name | 1-tert-butylsulfonyl-3-(trifluoromethyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 112737857 |
| Molecular Formula | C9H16F3NO3S |
| Molecular Weight | 275.29 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 1-tert-butylsulfonyl-3-(trifluoromethyl)pyrrolidin-3-ol |
| SMILES | CC(C)(C)S(=O)(=O)N1CCC(O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C9H16F3NO3S/c1-7(2,3)17(15,16)13-5-4-8(14,6-13)9(10,11)12/h14H,4-6H2,1-3H3 |
| InChIKey | PGBHSPCGZUUMNW-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.29 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |