C10H16F3NO3S — CID 113318700
1-cyclopentylsulfonyl-3-(trifluoromethyl)pyrrolidin-3-ol (PubChem CID 113318700) has the molecular formula C10H16F3NO3S and a molecular weight of 287.30 g/mol. Its IUPAC name is 1-cyclopentylsulfonyl-3-(trifluoromethyl)pyrrolidin-3-ol.
| Compound Name | 1-cyclopentylsulfonyl-3-(trifluoromethyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 113318700 |
| Molecular Formula | C10H16F3NO3S |
| Molecular Weight | 287.30 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 1-cyclopentylsulfonyl-3-(trifluoromethyl)pyrrolidin-3-ol |
| SMILES | O=S(=O)(C1CCCC1)N1CCC(O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C10H16F3NO3S/c11-10(12,13)9(15)5-6-14(7-9)18(16,17)8-3-1-2-4-8/h8,15H,1-7H2 |
| InChIKey | UHGMTYZXKFTQTG-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.30 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |