C21H27N7NaO12P — CID 135565098
sodium [(2R,3R,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-2-(hydroxymethyl)-4-methoxyoxolan-3-yl] [(2R,3S,5R)-2-(hydroxymethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] phosphate (PubChem CID 135565098) has the molecular formula C21H27N7NaO12P and a molecular weight of 623.45 g/mol. Its IUPAC name is sodium [(2R,3R,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-2-(hydroxymethyl)-4-methoxyoxolan-3-yl] [(2R,3S,5R)-2-(hydroxymethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] phosphate.
| Compound Name | sodium [(2R,3R,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-2-(hydroxymethyl)-4-methoxyoxolan-3-yl] [(2R,3S,5R)-2-(hydroxymethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] phosphate |
|---|---|
| PubChem CID | 135565098 |
| Molecular Formula | C21H27N7NaO12P |
| Molecular Weight | 623.45 g/mol |
| Exact Mass | 623.14 |
| IUPAC Name | sodium [(2R,3R,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-2-(hydroxymethyl)-4-methoxyoxolan-3-yl] [(2R,3S,5R)-2-(hydroxymethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] phosphate |
| SMILES | CO[C@@H]1[C@H](OP(=O)([O-])O[C@H]2C[C@H](n3cc(C)c(=O)[nH]c3=O)O[C@@H]2CO)[C@@H](CO)O[C@H]1n1cnc2c(=O)[nH]c(N)nc21.[Na+] |
| InChI | InChI=1S/C21H28N7O12P.Na/c1-8-4-27(21(33)26-17(8)31)12-3-9(10(5-29)37-12)39-41(34,35)40-14-11(6-30)38-19(15(14)36-2)28-7-23-13-16(28)24-20(22)25-18(13)32;/h4,7,9-12,14-15,19,29-30H,3,5-6H2,1-2H3,(H,34,35)(H,26,31,33)(H3,22,24,25,32);/q;+1/p-1/t9-,10+,11+,12+,14+,15+,19+;/m0./s1 |
| InChIKey | YGCYNXYBMZBEIT-CZNRTMFVSA-M |
| XLogP | -6.01 |
| TPSA | 271.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.45 |
| LogP ≤ 5 | -6.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|