C18H11F2NO4 — CID 135567210
(4-fluoro-2,3-dihydroxyphenyl)-[6-(2-fluoro-3-hydroxyphenyl)-2-pyridinyl]methanone (PubChem CID 135567210) has the molecular formula C18H11F2NO4 and a molecular weight of 343.29 g/mol. Its IUPAC name is (4-fluoro-2,3-dihydroxyphenyl)-[6-(2-fluoro-3-hydroxyphenyl)-2-pyridinyl]methanone.
| Compound Name | (4-fluoro-2,3-dihydroxyphenyl)-[6-(2-fluoro-3-hydroxyphenyl)-2-pyridinyl]methanone |
|---|---|
| PubChem CID | 135567210 |
| Molecular Formula | C18H11F2NO4 |
| Molecular Weight | 343.29 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | (4-fluoro-2,3-dihydroxyphenyl)-[6-(2-fluoro-3-hydroxyphenyl)-2-pyridinyl]methanone |
| SMILES | O=C(c1cccc(-c2cccc(O)c2F)n1)c1ccc(F)c(O)c1O |
| InChI | InChI=1S/C18H11F2NO4/c19-11-8-7-10(17(24)18(11)25)16(23)13-5-2-4-12(21-13)9-3-1-6-14(22)15(9)20/h1-8,22,24-25H |
| InChIKey | ACRZIJAMHSRKJJ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.29 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|