C21H17ClN4O6S — CID 135571355
3-(5-chloro-2-hydroxyphenyl)-5-(1,1-dioxothiolan-3-yl)-4-(3-nitrophenyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one (PubChem CID 135571355) has the molecular formula C21H17ClN4O6S and a molecular weight of 488.91 g/mol. Its IUPAC name is 3-(5-chloro-2-hydroxyphenyl)-5-(1,1-dioxothiolan-3-yl)-4-(3-nitrophenyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one.
| Compound Name | 3-(5-chloro-2-hydroxyphenyl)-5-(1,1-dioxothiolan-3-yl)-4-(3-nitrophenyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one |
|---|---|
| PubChem CID | 135571355 |
| Molecular Formula | C21H17ClN4O6S |
| Molecular Weight | 488.91 g/mol |
| Exact Mass | 488.06 |
| IUPAC Name | 3-(5-chloro-2-hydroxyphenyl)-5-(1,1-dioxothiolan-3-yl)-4-(3-nitrophenyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one |
| SMILES | O=C1c2[nH]nc(-c3cc(Cl)ccc3O)c2C(c2cccc([N+](=O)[O-])c2)N1C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C21H17ClN4O6S/c22-12-4-5-16(27)15(9-12)18-17-19(24-23-18)21(28)25(14-6-7-33(31,32)10-14)20(17)11-2-1-3-13(8-11)26(29)30/h1-5,8-9,14,20,27H,6-7,10H2,(H,23,24) |
| InChIKey | VVAQTZAFZSWPNX-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 146.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.91 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|