C24H26I2N6O3 — CID 135572193
(NZ)-N-[[1-benzyl-3-[[3-benzyl-2-[(Z)-hydroxyiminomethyl]imidazol-3-ium-1-yl]methoxymethyl]imidazol-1-ium-2-yl]methylidene]hydroxylamine diiodide (PubChem CID 135572193) has the molecular formula C24H26I2N6O3 and a molecular weight of 700.32 g/mol. Its IUPAC name is (NZ)-N-[[1-benzyl-3-[[3-benzyl-2-[(Z)-hydroxyiminomethyl]imidazol-3-ium-1-yl]methoxymethyl]imidazol-1-ium-2-yl]methylidene]hydroxylamine diiodide.
| Compound Name | (NZ)-N-[[1-benzyl-3-[[3-benzyl-2-[(Z)-hydroxyiminomethyl]imidazol-3-ium-1-yl]methoxymethyl]imidazol-1-ium-2-yl]methylidene]hydroxylamine diiodide |
|---|---|
| PubChem CID | 135572193 |
| Molecular Formula | C24H26I2N6O3 |
| Molecular Weight | 700.32 g/mol |
| Exact Mass | 700.02 |
| IUPAC Name | (NZ)-N-[[1-benzyl-3-[[3-benzyl-2-[(Z)-hydroxyiminomethyl]imidazol-3-ium-1-yl]methoxymethyl]imidazol-1-ium-2-yl]methylidene]hydroxylamine diiodide |
| SMILES | O/N=C\c1n(COCn2cc[n+](Cc3ccccc3)c2/C=N\O)cc[n+]1Cc1ccccc1.[I-].[I-] |
| InChI | InChI=1S/C24H24N6O3.2HI/c31-25-15-23-27(17-21-7-3-1-4-8-21)11-13-29(23)19-33-20-30-14-12-28(24(30)16-26-32)18-22-9-5-2-6-10-22;;/h1-16H,17-20H2;2*1H |
| InChIKey | NSNSQRMBQLYAHS-UHFFFAOYSA-N |
| XLogP | -3.78 |
| TPSA | 92.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.32 |
| LogP ≤ 5 | -3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|