C12H14N3O+ — CID 135524592
(NE)-N-[(1-benzyl-3-methylimidazol-3-ium-2-yl)methylidene]hydroxylamine (PubChem CID 135524592) has the molecular formula C12H14N3O+ and a molecular weight of 216.26 g/mol. Its IUPAC name is (NE)-N-[(1-benzyl-3-methylimidazol-3-ium-2-yl)methylidene]hydroxylamine.
| Compound Name | (NE)-N-[(1-benzyl-3-methylimidazol-3-ium-2-yl)methylidene]hydroxylamine |
|---|---|
| PubChem CID | 135524592 |
| Molecular Formula | C12H14N3O+ |
| Molecular Weight | 216.26 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | (NE)-N-[(1-benzyl-3-methylimidazol-3-ium-2-yl)methylidene]hydroxylamine |
| SMILES | C[n+]1ccn(Cc2ccccc2)c1/C=N/O |
| InChI | InChI=1S/C12H13N3O/c1-14-7-8-15(12(14)9-13-16)10-11-5-3-2-4-6-11/h2-9H,10H2,1H3/p+1 |
| InChIKey | ATZZOMOIYARQEI-UHFFFAOYSA-O |
| XLogP | 1.17 |
| TPSA | 41.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.26 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|