C11H16ClN3O — CID 135770425
(NZ)-N-[(1-hex-5-ynyl-3-methylimidazol-3-ium-2-yl)methylidene]hydroxylamine chloride (PubChem CID 135770425) has the molecular formula C11H16ClN3O and a molecular weight of 241.72 g/mol. Its IUPAC name is (NZ)-N-[(1-hex-5-ynyl-3-methylimidazol-3-ium-2-yl)methylidene]hydroxylamine chloride.
| Compound Name | (NZ)-N-[(1-hex-5-ynyl-3-methylimidazol-3-ium-2-yl)methylidene]hydroxylamine chloride |
|---|---|
| PubChem CID | 135770425 |
| Molecular Formula | C11H16ClN3O |
| Molecular Weight | 241.72 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | (NZ)-N-[(1-hex-5-ynyl-3-methylimidazol-3-ium-2-yl)methylidene]hydroxylamine chloride |
| SMILES | C#CCCCCn1cc[n+](C)c1/C=N\O.[Cl-] |
| InChI | InChI=1S/C11H15N3O.ClH/c1-3-4-5-6-7-14-9-8-13(2)11(14)10-12-15;/h1,8-10H,4-7H2,2H3;1H |
| InChIKey | CZSDGHVNIUROET-UHFFFAOYSA-N |
| XLogP | -2.07 |
| TPSA | 41.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.72 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|