C16H26Br2N6O2 — CID 135678169
(NZ)-N-[[1-[6-[2-[(Z)-hydroxyiminomethyl]-3-methylimidazol-3-ium-1-yl]hexyl]-3-methylimidazol-3-ium-2-yl]methylidene]hydroxylamine dibromide (PubChem CID 135678169) has the molecular formula C16H26Br2N6O2 and a molecular weight of 494.23 g/mol. Its IUPAC name is (NZ)-N-[[1-[6-[2-[(Z)-hydroxyiminomethyl]-3-methylimidazol-3-ium-1-yl]hexyl]-3-methylimidazol-3-ium-2-yl]methylidene]hydroxylamine dibromide.
| Compound Name | (NZ)-N-[[1-[6-[2-[(Z)-hydroxyiminomethyl]-3-methylimidazol-3-ium-1-yl]hexyl]-3-methylimidazol-3-ium-2-yl]methylidene]hydroxylamine dibromide |
|---|---|
| PubChem CID | 135678169 |
| Molecular Formula | C16H26Br2N6O2 |
| Molecular Weight | 494.23 g/mol |
| Exact Mass | 492.05 |
| IUPAC Name | (NZ)-N-[[1-[6-[2-[(Z)-hydroxyiminomethyl]-3-methylimidazol-3-ium-1-yl]hexyl]-3-methylimidazol-3-ium-2-yl]methylidene]hydroxylamine dibromide |
| SMILES | C[n+]1ccn(CCCCCCn2cc[n+](C)c2/C=N\O)c1/C=N\O.[Br-].[Br-] |
| InChI | InChI=1S/C16H24N6O2.2BrH/c1-19-9-11-21(15(19)13-17-23)7-5-3-4-6-8-22-12-10-20(2)16(22)14-18-24;;/h9-14H,3-8H2,1-2H3;2*1H |
| InChIKey | DCSKEBWZYRDYIJ-UHFFFAOYSA-N |
| XLogP | -5.18 |
| TPSA | 82.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.23 |
| LogP ≤ 5 | -5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|