C10H18IN3O — CID 144831504
N-[(1-methyl-3-pentylimidazol-1-ium-2-yl)methylidene]hydroxylamine iodide (PubChem CID 144831504) has the molecular formula C10H18IN3O and a molecular weight of 323.18 g/mol. Its IUPAC name is N-[(1-methyl-3-pentylimidazol-1-ium-2-yl)methylidene]hydroxylamine iodide.
| Compound Name | N-[(1-methyl-3-pentylimidazol-1-ium-2-yl)methylidene]hydroxylamine iodide |
|---|---|
| PubChem CID | 144831504 |
| Molecular Formula | C10H18IN3O |
| Molecular Weight | 323.18 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | N-[(1-methyl-3-pentylimidazol-1-ium-2-yl)methylidene]hydroxylamine iodide |
| SMILES | CCCCCn1cc[n+](C)c1C=NO.[I-] |
| InChI | InChI=1S/C10H17N3O.HI/c1-3-4-5-6-13-8-7-12(2)10(13)9-11-14;/h7-9H,3-6H2,1-2H3;1H |
| InChIKey | XLJJDFKVMMKPPI-UHFFFAOYSA-N |
| XLogP | -1.69 |
| TPSA | 41.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.18 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|